C13H23NO2 — CID 107178837
2,2-dimethyl-N-(3-oxobutan-2-yl)cyclohexane-1-carboxamide (PubChem CID 107178837) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-oxobutan-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 2,2-dimethyl-N-(3-oxobutan-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107178837 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2,2-dimethyl-N-(3-oxobutan-2-yl)cyclohexane-1-carboxamide |
| SMILES | CC(=O)C(C)NC(=O)C1CCCCC1(C)C |
| InChI | InChI=1S/C13H23NO2/c1-9(10(2)15)14-12(16)11-7-5-6-8-13(11,3)4/h9,11H,5-8H2,1-4H3,(H,14,16) |
| InChIKey | NZSQEBDVJFWOTI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |