C14H26INO — CID 107859802
N-(1-iodo-3-methylbutan-2-yl)-2,2-dimethylcyclohexane-1-carboxamide (PubChem CID 107859802) has the molecular formula C14H26INO and a molecular weight of 351.27 g/mol. Its IUPAC name is N-(1-iodo-3-methylbutan-2-yl)-2,2-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-(1-iodo-3-methylbutan-2-yl)-2,2-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107859802 |
| Molecular Formula | C14H26INO |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(1-iodo-3-methylbutan-2-yl)-2,2-dimethylcyclohexane-1-carboxamide |
| SMILES | CC(C)C(CI)NC(=O)C1CCCCC1(C)C |
| InChI | InChI=1S/C14H26INO/c1-10(2)12(9-15)16-13(17)11-7-5-6-8-14(11,3)4/h10-12H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | IPVIOYDMFDWAIF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|