C8H14N2O3 — CID 103901247
N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 103901247) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103901247 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)NOCC(N)=O |
| InChI | InChI=1S/C8H14N2O3/c1-8(2)3-5(8)7(12)10-13-4-6(9)11/h5H,3-4H2,1-2H3,(H2,9,11)(H,10,12) |
| InChIKey | WHVWWKYOISPWJG-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|