C10H19NO2 — CID 90243249
4-hydroxy-2,2,4-trimethylcyclohexane-1-carboxamide (PubChem CID 90243249) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-hydroxy-2,2,4-trimethylcyclohexane-1-carboxamide.
| Compound Name | 4-hydroxy-2,2,4-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90243249 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 4-hydroxy-2,2,4-trimethylcyclohexane-1-carboxamide |
| SMILES | CC1(O)CCC(C(N)=O)C(C)(C)C1 |
| InChI | InChI=1S/C10H19NO2/c1-9(2)6-10(3,13)5-4-7(9)8(11)12/h7,13H,4-6H2,1-3H3,(H2,11,12) |
| InChIKey | AAXCUZKIBUDAII-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |