C11H23NO3 — CID 144739628
cis-(1S,4R)-4-amino-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid;ethane (PubChem CID 144739628) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is cis-(1S,4R)-4-amino-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid;ethane.
| Compound Name | cis-(1S,4R)-4-amino-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144739628 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | cis-(1S,4R)-4-amino-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid;ethane |
| SMILES | CC.CC1(C)C[C@](N)(O)CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H17NO3.C2H6/c1-8(2)5-9(10,13)4-3-6(8)7(11)12;1-2/h6,13H,3-5,10H2,1-2H3,(H,11,12);1-2H3/t6-,9-;/m1./s1 |
| InChIKey | ZADXNCWRYPDSGH-SOWVLMPRSA-N |
| XLogP | 1.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|