C9H19N3 — CID 107183066
N'-amino-2,2-dimethylcyclohexane-1-carboximidamide (PubChem CID 107183066) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is N'-amino-2,2-dimethylcyclohexane-1-carboximidamide.
| Compound Name | N'-amino-2,2-dimethylcyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 107183066 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N'-amino-2,2-dimethylcyclohexane-1-carboximidamide |
| SMILES | CC1(C)CCCCC1C(N)=NN |
| InChI | InChI=1S/C9H19N3/c1-9(2)6-4-3-5-7(9)8(10)12-11/h7H,3-6,11H2,1-2H3,(H2,10,12) |
| InChIKey | CSYGKXAPNIXTEB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|