C22H28O9 — CID 102354854
tetramethyl (4aS,4bS,8aS,10aS)-5-oxo-3,4,4a,4b,6,8,8a,10a-octahydro-1H-phenanthrene-2,2,7,7-tetracarboxylate (PubChem CID 102354854) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is tetramethyl (4aS,4bS,8aS,10aS)-5-oxo-3,4,4a,4b,6,8,8a,10a-octahydro-1H-phenanthrene-2,2,7,7-tetracarboxylate.
| Compound Name | tetramethyl (4aS,4bS,8aS,10aS)-5-oxo-3,4,4a,4b,6,8,8a,10a-octahydro-1H-phenanthrene-2,2,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 102354854 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | tetramethyl (4aS,4bS,8aS,10aS)-5-oxo-3,4,4a,4b,6,8,8a,10a-octahydro-1H-phenanthrene-2,2,7,7-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@@H]2[C@H]3C(=O)CC(C(=O)OC)(C(=O)OC)C[C@H]3C=C[C@@H]2C1 |
| InChI | InChI=1S/C22H28O9/c1-28-17(24)21(18(25)29-2)8-7-14-12(9-21)5-6-13-10-22(19(26)30-3,20(27)31-4)11-15(23)16(13)14/h5-6,12-14,16H,7-11H2,1-4H3/t12-,13-,14+,16+/m1/s1 |
| InChIKey | VFFQAJMIPRALLX-NYTXWWLZSA-N |
| XLogP | 1.23 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|