C22H32O7 — CID 100940980
dimethyl (4bR,7R,8R,8aR)-7-(methoxymethoxy)-4b,8-dimethyl-4-oxo-3,4a,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-2,2-dicarboxylate (PubChem CID 100940980) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is dimethyl (4bR,7R,8R,8aR)-7-(methoxymethoxy)-4b,8-dimethyl-4-oxo-3,4a,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-2,2-dicarboxylate.
| Compound Name | dimethyl (4bR,7R,8R,8aR)-7-(methoxymethoxy)-4b,8-dimethyl-4-oxo-3,4a,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 100940980 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | dimethyl (4bR,7R,8R,8aR)-7-(methoxymethoxy)-4b,8-dimethyl-4-oxo-3,4a,5,6,7,8,8a,10a-octahydro-1H-phenanthrene-2,2-dicarboxylate |
| SMILES | COCO[C@@H]1CC[C@@]2(C)C3C(=O)CC(C(=O)OC)(C(=O)OC)CC3C=C[C@@H]2[C@H]1C |
| InChI | InChI=1S/C22H32O7/c1-13-15-7-6-14-10-22(19(24)27-4,20(25)28-5)11-16(23)18(14)21(15,2)9-8-17(13)29-12-26-3/h6-7,13-15,17-18H,8-12H2,1-5H3/t13-,14?,15-,17-,18?,21-/m1/s1 |
| InChIKey | JNIJYGHBWUABHT-XGDJTNGTSA-N |
| XLogP | 2.53 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|