C21H34O5 — CID 10992184
methyl (1S,2S,4aR,4bR,7R,8aS,10aS)-7-(hydroxymethyl)-2-(methoxymethoxy)-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 10992184) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (1S,2S,4aR,4bR,7R,8aS,10aS)-7-(hydroxymethyl)-2-(methoxymethoxy)-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1S,2S,4aR,4bR,7R,8aS,10aS)-7-(hydroxymethyl)-2-(methoxymethoxy)-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10992184 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | methyl (1S,2S,4aR,4bR,7R,8aS,10aS)-7-(hydroxymethyl)-2-(methoxymethoxy)-4a,7-dimethyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | COCO[C@H]1CC[C@]2(C)[C@@H]3CC[C@@](C)(CO)C[C@H]3C=C[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C21H34O5/c1-20(12-22)9-7-15-14(11-20)5-6-16-18(19(23)25-4)17(26-13-24-3)8-10-21(15,16)2/h5-6,14-18,22H,7-13H2,1-4H3/t14-,15-,16+,17+,18+,20-,21-/m1/s1 |
| InChIKey | GNUXWAJUWSFTFS-FAHRLCJRSA-N |
| XLogP | 3.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|