C23H34O8 — CID 11212791
trimethyl (1S,2S,4aR,4bR,8aS,10aS)-2-(methoxymethoxy)-4a-methyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1,7,7-tricarboxylate (PubChem CID 11212791) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is trimethyl (1S,2S,4aR,4bR,8aS,10aS)-2-(methoxymethoxy)-4a-methyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1,7,7-tricarboxylate.
| Compound Name | trimethyl (1S,2S,4aR,4bR,8aS,10aS)-2-(methoxymethoxy)-4a-methyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1,7,7-tricarboxylate |
|---|---|
| PubChem CID | 11212791 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | trimethyl (1S,2S,4aR,4bR,8aS,10aS)-2-(methoxymethoxy)-4a-methyl-1,2,3,4,4b,5,6,8,8a,10a-decahydrophenanthrene-1,7,7-tricarboxylate |
| SMILES | COCO[C@H]1CC[C@]2(C)[C@@H]3CCC(C(=O)OC)(C(=O)OC)C[C@H]3C=C[C@H]2[C@@H]1C(=O)OC |
| InChI | InChI=1S/C23H34O8/c1-22-10-9-17(31-13-27-2)18(19(24)28-3)16(22)7-6-14-12-23(20(25)29-4,21(26)30-5)11-8-15(14)22/h6-7,14-18H,8-13H2,1-5H3/t14-,15-,16+,17+,18+,22-/m1/s1 |
| InChIKey | DYCLTFMLENLJGZ-NQRGENJPSA-N |
| XLogP | 2.50 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|