C21H32O9 — CID 11133728
trimethyl (1S,2S,4aR,4bR,8aR,9R,10S,10aS)-2,9,10-trihydroxy-4a-methyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-1,7,7-tricarboxylate (PubChem CID 11133728) has the molecular formula C21H32O9 and a molecular weight of 428.48 g/mol. Its IUPAC name is trimethyl (1S,2S,4aR,4bR,8aR,9R,10S,10aS)-2,9,10-trihydroxy-4a-methyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-1,7,7-tricarboxylate.
| Compound Name | trimethyl (1S,2S,4aR,4bR,8aR,9R,10S,10aS)-2,9,10-trihydroxy-4a-methyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-1,7,7-tricarboxylate |
|---|---|
| PubChem CID | 11133728 |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | trimethyl (1S,2S,4aR,4bR,8aR,9R,10S,10aS)-2,9,10-trihydroxy-4a-methyl-1,2,3,4,4b,5,6,8,8a,9,10,10a-dodecahydrophenanthrene-1,7,7-tricarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2[C@H](O)[C@H](O)[C@@H]3CC(C(=O)OC)(C(=O)OC)CC[C@H]3[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C21H32O9/c1-20-7-6-12(22)13(17(25)28-2)14(20)16(24)15(23)10-9-21(18(26)29-3,19(27)30-4)8-5-11(10)20/h10-16,22-24H,5-9H2,1-4H3/t10-,11-,12+,13-,14-,15-,16+,20-/m1/s1 |
| InChIKey | QEOPSNYTCSRUAY-GMOBSDORSA-N |
| XLogP | 0.04 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|