C22H36O5 — CID 20634660
(3,6,7-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl) acetate (PubChem CID 20634660) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (3,6,7-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl) acetate.
| Compound Name | (3,6,7-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl) acetate |
|---|---|
| PubChem CID | 20634660 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (3,6,7-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-4-yl) acetate |
| SMILES | CC(=O)OC1C(O)CCC2(C)C3CCC4(C)CC(C)CC4C3C(O)C(O)C12 |
| InChI | InChI=1S/C22H36O5/c1-11-9-14-16-13(5-7-21(14,3)10-11)22(4)8-6-15(24)20(27-12(2)23)17(22)19(26)18(16)25/h11,13-20,24-26H,5-10H2,1-4H3 |
| InChIKey | UNZUUBNNJIUZME-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |