C27H36O4 — CID 118691087
(6,7-dihydroxy-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 118691087) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is (6,7-dihydroxy-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (6,7-dihydroxy-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 118691087 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (6,7-dihydroxy-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(C1)C(O)C(O)C1C3CC=C(c4ccccc4)C3(C)CCC12 |
| InChI | InChI=1S/C27H36O4/c1-16(28)31-18-11-13-27(3)21-12-14-26(2)19(17-7-5-4-6-8-17)9-10-20(26)23(21)25(30)24(29)22(27)15-18/h4-9,18,20-25,29-30H,10-15H2,1-3H3 |
| InChIKey | MDVKYEXKJHQVHS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |