C29H40O2 — CID 130376997
(2R,6R,7S,9S,12R,13S,16S,20S)-4,4,9,12,16-pentamethyl-17-phenyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-17-ene (PubChem CID 130376997) has the molecular formula C29H40O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (2R,6R,7S,9S,12R,13S,16S,20S)-4,4,9,12,16-pentamethyl-17-phenyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-17-ene.
| Compound Name | (2R,6R,7S,9S,12R,13S,16S,20S)-4,4,9,12,16-pentamethyl-17-phenyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-17-ene |
|---|---|
| PubChem CID | 130376997 |
| Molecular Formula | C29H40O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (2R,6R,7S,9S,12R,13S,16S,20S)-4,4,9,12,16-pentamethyl-17-phenyl-3,5-dioxapentacyclo[11.7.0.02,6.07,12.016,20]icos-17-ene |
| SMILES | C[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(c5ccccc5)=CC[C@H]4C3[C@H]3OC(C)(C)O[C@@H]3[C@H]2C1 |
| InChI | InChI=1S/C29H40O2/c1-18-13-15-29(5)22-14-16-28(4)20(19-9-7-6-8-10-19)11-12-21(28)24(22)26-25(23(29)17-18)30-27(2,3)31-26/h6-11,18,21-26H,12-17H2,1-5H3/t18-,21-,22?,23+,24?,25+,26+,28+,29+/m0/s1 |
| InChIKey | GQNQAIOPCOCXAY-KPYNSTMSSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |