C25H34O3 — CID 118696638
(3S,5S,6R,7R,9S,10R,13S,14S)-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol (PubChem CID 118696638) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (3S,5S,6R,7R,9S,10R,13S,14S)-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol.
| Compound Name | (3S,5S,6R,7R,9S,10R,13S,14S)-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol |
|---|---|
| PubChem CID | 118696638 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (3S,5S,6R,7R,9S,10R,13S,14S)-10,13-dimethyl-17-phenyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1[C@@H](O)C(O)C1[C@@H]2CC[C@]2(C)C(c3ccccc3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H34O3/c1-24-13-11-19-21(18(24)9-8-17(24)15-6-4-3-5-7-15)23(28)22(27)20-14-16(26)10-12-25(19,20)2/h3-8,16,18-23,26-28H,9-14H2,1-2H3/t16-,18-,19-,20+,21?,22+,23?,24+,25+/m0/s1 |
| InChIKey | GCMLSSPMOMNXCM-DSYGQAIFSA-N |
| XLogP | 4.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |