C28H37NO — CID 70958146
(3R,5S,10S,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol (PubChem CID 70958146) has the molecular formula C28H37NO and a molecular weight of 403.61 g/mol. Its IUPAC name is (3R,5S,10S,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol.
| Compound Name | (3R,5S,10S,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol |
|---|---|
| PubChem CID | 70958146 |
| Molecular Formula | C28H37NO |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | (3R,5S,10S,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| SMILES | C[C@@H]1CC[C@]2(C)C3CC[C@]4(C)C(n5ccc6ccccc65)=CCC4C3C(O)C[C@@H]2C1 |
| InChI | InChI=1S/C28H37NO/c1-18-10-13-27(2)20(16-18)17-24(30)26-21-8-9-25(28(21,3)14-11-22(26)27)29-15-12-19-6-4-5-7-23(19)29/h4-7,9,12,15,18,20-22,24,26,30H,8,10-11,13-14,16-17H2,1-3H3/t18-,20+,21?,22?,24?,26?,27+,28+/m1/s1 |
| InChIKey | BTIJGRRCWVZXKS-HHYPPMFGSA-N |
| XLogP | 6.74 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |