C31H35N3O2 — CID 160943787
[(3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] imidazole-1-carboxylate (PubChem CID 160943787) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is [(3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] imidazole-1-carboxylate.
| Compound Name | [(3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 160943787 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | [(3S,10R,13S)-17-indol-1-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] imidazole-1-carboxylate |
| SMILES | C[C@]12CC[C@H](OC(=O)n3ccnc3)CC1=CCC1C2CC[C@]2(C)C(n3ccc4ccccc43)=CCC12 |
| InChI | InChI=1S/C31H35N3O2/c1-30-14-11-23(36-29(35)33-18-16-32-20-33)19-22(30)7-8-24-25-9-10-28(31(25,2)15-12-26(24)30)34-17-13-21-5-3-4-6-27(21)34/h3-7,10,13,16-18,20,23-26H,8-9,11-12,14-15,19H2,1-2H3/t23-,24?,25?,26?,30-,31-/m0/s1 |
| InChIKey | JLQJSPCCPFTEJP-MJTLHZCXSA-N |
| XLogP | 7.30 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|