C28H37N2O2P — CID 58266251
1-[(3S,10R,13S)-3-dimethylphosphoryloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole (PubChem CID 58266251) has the molecular formula C28H37N2O2P and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-[(3S,10R,13S)-3-dimethylphosphoryloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole.
| Compound Name | 1-[(3S,10R,13S)-3-dimethylphosphoryloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
|---|---|
| PubChem CID | 58266251 |
| Molecular Formula | C28H37N2O2P |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 1-[(3S,10R,13S)-3-dimethylphosphoryloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
| SMILES | C[C@]12CC[C@H](OP(C)(C)=O)CC1=CCC1C2CC[C@]2(C)C(n3cnc4ccccc43)=CCC12 |
| InChI | InChI=1S/C28H37N2O2P/c1-27-15-13-20(32-33(3,4)31)17-19(27)9-10-21-22-11-12-26(28(22,2)16-14-23(21)27)30-18-29-24-7-5-6-8-25(24)30/h5-9,12,18,20-23H,10-11,13-17H2,1-4H3/t20-,21?,22?,23?,27-,28-/m0/s1 |
| InChIKey | XKZFVNLSSHCULI-JFIFQLOXSA-N |
| XLogP | 7.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|