C27H35N3 — CID 123895472
17-(benzimidazol-1-yl)-N,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 123895472) has the molecular formula C27H35N3 and a molecular weight of 401.60 g/mol. Its IUPAC name is 17-(benzimidazol-1-yl)-N,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | 17-(benzimidazol-1-yl)-N,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 123895472 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 17-(benzimidazol-1-yl)-N,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | CNC1CCC2(C)C(=CCC3C2CCC2(C)C(n4cnc5ccccc54)=CCC32)C1 |
| InChI | InChI=1S/C27H35N3/c1-26-14-12-19(28-3)16-18(26)8-9-20-21-10-11-25(27(21,2)15-13-22(20)26)30-17-29-23-6-4-5-7-24(23)30/h4-8,11,17,19-22,28H,9-10,12-16H2,1-3H3 |
| InChIKey | DOBFGSYWSONIKC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|