C30H36N2O5 — CID 71733624
2-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethoxy]acetic acid (PubChem CID 71733624) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 71733624 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[2-[[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethoxy]acetic acid |
| SMILES | C[C@]12CC[C@H](OC(=O)COCC(=O)O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C30H36N2O5/c1-29-13-11-20(37-28(35)17-36-16-27(33)34)15-19(29)7-8-21-22-9-10-26(30(22,2)14-12-23(21)29)32-18-31-24-5-3-4-6-25(24)32/h3-7,10,18,20-23H,8-9,11-17H2,1-2H3,(H,33,34)/t20-,21-,22-,23-,29-,30-/m0/s1 |
| InChIKey | HYKBTYZJTKWWLZ-JISQPLMFSA-N |
| XLogP | 5.46 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|