C36H47N3O2 — CID 141497247
[(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-(cyclopropylmethyl)piperidine-4-carboxylate (PubChem CID 141497247) has the molecular formula C36H47N3O2 and a molecular weight of 553.79 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-(cyclopropylmethyl)piperidine-4-carboxylate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 141497247 |
| Molecular Formula | C36H47N3O2 |
| Molecular Weight | 553.79 g/mol |
| Exact Mass | 553.37 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-(cyclopropylmethyl)piperidine-4-carboxylate |
| SMILES | C[C@]12CC[C@H](OC(=O)C3CCN(CC4CC4)CC3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C36H47N3O2/c1-35-17-13-27(41-34(40)25-15-19-38(20-16-25)22-24-7-8-24)21-26(35)9-10-28-29-11-12-33(36(29,2)18-14-30(28)35)39-23-37-31-5-3-4-6-32(31)39/h3-6,9,12,23-25,27-30H,7-8,10-11,13-22H2,1-2H3/t27-,28-,29-,30-,35-,36-/m0/s1 |
| InChIKey | UBCXLMUARBNNJQ-AVMXUKBZSA-N |
| XLogP | 7.48 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.79 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|