C31H37N5O — CID 172549368
N-[(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]-2H-pyrazine-1-carboxamide (PubChem CID 172549368) has the molecular formula C31H37N5O and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]-2H-pyrazine-1-carboxamide.
| Compound Name | N-[(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]-2H-pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 172549368 |
| Molecular Formula | C31H37N5O |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | N-[(3S,10R,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl]-2H-pyrazine-1-carboxamide |
| SMILES | C[C@]12CC[C@H](NC(=O)N3C=CN=CC3)CC1=CCC1C2CC[C@]2(C)C(n3cnc4ccccc43)=CCC12 |
| InChI | InChI=1S/C31H37N5O/c1-30-13-11-22(34-29(37)35-17-15-32-16-18-35)19-21(30)7-8-23-24-9-10-28(31(24,2)14-12-25(23)30)36-20-33-26-5-3-4-6-27(26)36/h3-7,10,15-17,20,22-25H,8-9,11-14,18-19H2,1-2H3,(H,34,37)/t22-,23?,24?,25?,30-,31-/m0/s1 |
| InChIKey | ITAJIHZOLSGWOM-MLFHCEEJSA-N |
| XLogP | 6.39 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|