C28H35N — CID 70958189
1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]indole (PubChem CID 70958189) has the molecular formula C28H35N and a molecular weight of 385.60 g/mol. Its IUPAC name is 1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]indole.
| Compound Name | 1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]indole |
|---|---|
| PubChem CID | 70958189 |
| Molecular Formula | C28H35N |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]indole |
| SMILES | C[C@@H]1C=C2CCC3C(CC[C@]4(C)C(n5ccc6ccccc65)=CCC34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C28H35N/c1-19-12-15-27(2)21(18-19)8-9-22-23-10-11-26(28(23,3)16-13-24(22)27)29-17-14-20-6-4-5-7-25(20)29/h4-7,11,14,17-19,22-24H,8-10,12-13,15-16H2,1-3H3/t19-,22?,23?,24?,27-,28-/m0/s1 |
| InChIKey | MLOGOJOKYARQLX-QEFPSWQBSA-N |
| XLogP | 7.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|