C26H33N3 — CID 58266236
1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzotriazole (PubChem CID 58266236) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is 1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzotriazole.
| Compound Name | 1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzotriazole |
|---|---|
| PubChem CID | 58266236 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 1-[(3S,10R,13S)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzotriazole |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(n4nnc5ccccc54)=CCC32)C1 |
| InChI | InChI=1S/C26H33N3/c1-17-12-14-25(2)18(16-17)8-9-19-20-10-11-24(26(20,3)15-13-21(19)25)29-23-7-5-4-6-22(23)27-28-29/h4-8,11,17,19-21H,9-10,12-16H2,1-3H3/t17-,19?,20?,21?,25-,26-/m0/s1 |
| InChIKey | DYRKUUQRIVUZQC-IJBCHEEISA-N |
| XLogP | 6.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|