C28H35NO — CID 70958199
(3S,10R,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-12-ol (PubChem CID 70958199) has the molecular formula C28H35NO and a molecular weight of 401.59 g/mol. Its IUPAC name is (3S,10R,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-12-ol.
| Compound Name | (3S,10R,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-12-ol |
|---|---|
| PubChem CID | 70958199 |
| Molecular Formula | C28H35NO |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (3S,10R,13S)-17-indol-1-yl-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-12-ol |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CCC3C4CC=C(n5ccc6ccccc65)[C@@]4(C)C(O)CC32)C1 |
| InChI | InChI=1S/C28H35NO/c1-18-12-14-27(2)20(16-18)8-9-21-22-10-11-25(28(22,3)26(30)17-23(21)27)29-15-13-19-6-4-5-7-24(19)29/h4-8,11,13,15,18,21-23,26,30H,9-10,12,14,16-17H2,1-3H3/t18-,21?,22?,23?,26?,27-,28-/m0/s1 |
| InChIKey | RGLOBLYYRINVNX-HUAJOYHDSA-N |
| XLogP | 6.66 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|