C23H33N — CID 161013779
(3S,8R,9S,10R,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 161013779) has the molecular formula C23H33N and a molecular weight of 323.52 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,8R,9S,10R,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 161013779 |
| Molecular Formula | C23H33N |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17Z)-17-(1-isocyanoethylidene)-3,10,13-trimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | [C-]#[N+]/C(C)=C1/CC[C@H]2[C@@H]3CCC4=C[C@@H](C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H33N/c1-15-10-12-22(3)17(14-15)6-7-18-20-9-8-19(16(2)24-5)23(20,4)13-11-21(18)22/h14-15,18,20-21H,6-13H2,1-4H3/b19-16-/t15-,18-,20-,21-,22-,23+/m0/s1 |
| InChIKey | STUCXZRRRPZOTG-VOGKQZTESA-N |
| XLogP | 6.78 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|