C22H31NO — CID 123550537
(3R,8R,9S,10R,13S,14S,17Z)-17-(isocyanomethylidene)-3,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 123550537) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S,17Z)-17-(isocyanomethylidene)-3,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8R,9S,10R,13S,14S,17Z)-17-(isocyanomethylidene)-3,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 123550537 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S,17Z)-17-(isocyanomethylidene)-3,10,13-trimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | [C-]#[N+]/C=C1/CC[C@H]2[C@@H]3CCC4=C[C@](C)(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H31NO/c1-20(24)11-12-22(3)15(13-20)5-7-17-18-8-6-16(14-23-4)21(18,2)10-9-19(17)22/h13-14,17-19,24H,5-12H2,1-3H3/b16-14-/t17-,18-,19-,20+,21+,22-/m0/s1 |
| InChIKey | DAZRSQXUWKNFCI-DNDFXLIXSA-N |
| XLogP | 5.50 |
| TPSA | 24.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|