C21H28O2S — CID 158116201
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-sulfinylethylidene)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 158116201) has the molecular formula C21H28O2S and a molecular weight of 344.52 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-sulfinylethylidene)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-sulfinylethylidene)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 158116201 |
| Molecular Formula | C21H28O2S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-(2-sulfinylethylidene)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=CC=S=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H28O2S/c1-20-11-8-19-17(18(20)6-4-14(20)9-12-24-23)5-3-15-13-16(22)7-10-21(15,19)2/h9,12-13,17-19H,3-8,10-11H2,1-2H3/t17-,18-,19-,20+,21-/m0/s1 |
| InChIKey | FRAMWPUEQRUZQT-FCMAGTKHSA-N |
| XLogP | 4.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|