C22H30O — CID 124921630
(8R,9R,10R,13R,14R,17Z)-10,13-dimethyl-17-prop-2-enylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 124921630) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is (8R,9R,10R,13R,14R,17Z)-10,13-dimethyl-17-prop-2-enylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13R,14R,17Z)-10,13-dimethyl-17-prop-2-enylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 124921630 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (8R,9R,10R,13R,14R,17Z)-10,13-dimethyl-17-prop-2-enylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=C/C=C1/CC[C@@H]2[C@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C22H30O/c1-4-5-15-7-9-19-18-8-6-16-14-17(23)10-12-22(16,3)20(18)11-13-21(15,19)2/h4-5,14,18-20H,1,6-13H2,2-3H3/b15-5-/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | YDAROTPQYHWCPB-SINQXBQBSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |