C26H34N2O2 — CID 52938843
(3R,5S,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol (PubChem CID 52938843) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (3R,5S,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol.
| Compound Name | (3R,5S,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
|---|---|
| PubChem CID | 52938843 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (3R,5S,10S,13S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
| SMILES | C[C@]12CCC3C(C(O)C[C@@H]4C[C@H](O)CC[C@]34C)C1CC=C2n1cnc2ccccc21 |
| InChI | InChI=1S/C26H34N2O2/c1-25-11-9-17(29)13-16(25)14-22(30)24-18-7-8-23(26(18,2)12-10-19(24)25)28-15-27-20-5-3-4-6-21(20)28/h3-6,8,15-19,22,24,29-30H,7,9-14H2,1-2H3/t16-,17+,18?,19?,22?,24?,25-,26-/m0/s1 |
| InChIKey | XZDMXRUMNDKVGI-VAYIPFPTSA-N |
| XLogP | 4.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |