C26H30N2O2 — CID 52938585
(3S,10R,13S)-17-(benzimidazol-1-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-7-one (PubChem CID 52938585) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (3S,10R,13S)-17-(benzimidazol-1-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | (3S,10R,13S)-17-(benzimidazol-1-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 52938585 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (3S,10R,13S)-17-(benzimidazol-1-yl)-3-hydroxy-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-7-one |
| SMILES | C[C@]12CC[C@H](O)CC1=CC(=O)C1C2CC[C@]2(C)C(n3cnc4ccccc43)=CCC12 |
| InChI | InChI=1S/C26H30N2O2/c1-25-11-9-17(29)13-16(25)14-22(30)24-18-7-8-23(26(18,2)12-10-19(24)25)28-15-27-20-5-3-4-6-21(20)28/h3-6,8,14-15,17-19,24,29H,7,9-13H2,1-2H3/t17-,18?,19?,24?,25-,26-/m0/s1 |
| InChIKey | QZPXPVKECBXJNZ-VTXUGQQNSA-N |
| XLogP | 4.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |