C27H34N2 — CID 118900121
1-[(10S,13S)-3,10,13-trimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole (PubChem CID 118900121) has the molecular formula C27H34N2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 1-[(10S,13S)-3,10,13-trimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole.
| Compound Name | 1-[(10S,13S)-3,10,13-trimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
|---|---|
| PubChem CID | 118900121 |
| Molecular Formula | C27H34N2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-[(10S,13S)-3,10,13-trimethyl-2,3,4,5,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
| SMILES | CC1CC[C@@]2(C)C(C=CC3C2CC[C@]2(C)C(n4cnc5ccccc54)=CCC32)C1 |
| InChI | InChI=1S/C27H34N2/c1-18-12-14-26(2)19(16-18)8-9-20-21-10-11-25(27(21,3)15-13-22(20)26)29-17-28-23-6-4-5-7-24(23)29/h4-9,11,17-22H,10,12-16H2,1-3H3/t18?,19?,20?,21?,22?,26-,27-/m0/s1 |
| InChIKey | JWYRZMQYMBEEPV-SQTJTQQRSA-N |
| XLogP | 6.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|