C26H44O3 — CID 154516140
4-[(3R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid (PubChem CID 154516140) has the molecular formula C26H44O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 4-[(3R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid.
| Compound Name | 4-[(3R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 154516140 |
| Molecular Formula | C26H44O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 4-[(3R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid |
| SMILES | CC(CC(C)C1CCC2C3C(O)CC4C[C@H](C)CCC4(C)C3CCC12C)C(=O)O |
| InChI | InChI=1S/C26H44O3/c1-15-8-10-25(4)18(12-15)14-22(27)23-20-7-6-19(16(2)13-17(3)24(28)29)26(20,5)11-9-21(23)25/h15-23,27H,6-14H2,1-5H3,(H,28,29)/t15-,16?,17?,18?,19?,20?,21?,22?,23?,25?,26?/m1/s1 |
| InChIKey | CCWQBLLIRSQBLH-IHGSKWIMSA-N |
| XLogP | 6.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |