C29H52O6S — CID 140958213
[(6R)-3-(hydroxymethyl)-6-[(3S,5R,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-yl] hydrogen sulfate (PubChem CID 140958213) has the molecular formula C29H52O6S and a molecular weight of 528.80 g/mol. Its IUPAC name is [(6R)-3-(hydroxymethyl)-6-[(3S,5R,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-yl] hydrogen sulfate.
| Compound Name | [(6R)-3-(hydroxymethyl)-6-[(3S,5R,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140958213 |
| Molecular Formula | C29H52O6S |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | [(6R)-3-(hydroxymethyl)-6-[(3S,5R,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-yl] hydrogen sulfate |
| SMILES | CC(C)C(CO)(CC[C@@H](C)C1CCC2C3C(O)C[C@H]4C[C@@H](C)CC[C@]4(C)C3CC[C@@]21C)OS(=O)(=O)O |
| InChI | InChI=1S/C29H52O6S/c1-18(2)29(17-30,35-36(32,33)34)14-10-20(4)22-7-8-23-26-24(11-13-28(22,23)6)27(5)12-9-19(3)15-21(27)16-25(26)31/h18-26,30-31H,7-17H2,1-6H3,(H,32,33,34)/t19-,20+,21+,22?,23?,24?,25?,26?,27-,28+,29?/m0/s1 |
| InChIKey | PHPFRNXCMHLQDC-MGSVTLRNSA-N |
| XLogP | 5.88 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|