C34H40O3 — CID 124898784
[(3R,8R,9S,10R,13S,14S,16R,17S)-17-benzoyl-10,13-dimethyl-16-phenyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124898784) has the molecular formula C34H40O3 and a molecular weight of 496.69 g/mol. Its IUPAC name is [(3R,8R,9S,10R,13S,14S,16R,17S)-17-benzoyl-10,13-dimethyl-16-phenyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8R,9S,10R,13S,14S,16R,17S)-17-benzoyl-10,13-dimethyl-16-phenyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124898784 |
| Molecular Formula | C34H40O3 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | [(3R,8R,9S,10R,13S,14S,16R,17S)-17-benzoyl-10,13-dimethyl-16-phenyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]4C[C@@H](c5ccccc5)[C@H](C(=O)c5ccccc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C34H40O3/c1-22(35)37-26-16-18-33(2)25(20-26)14-15-27-29(33)17-19-34(3)30(27)21-28(23-10-6-4-7-11-23)31(34)32(36)24-12-8-5-9-13-24/h4-14,26-31H,15-21H2,1-3H3/t26-,27+,28+,29+,30+,31-,33+,34+/m1/s1 |
| InChIKey | JWFNKWCLKCAFGV-FHNFUHDTSA-N |
| XLogP | 7.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|