C30H39N3O3 — CID 155556013
[(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(1H-benzimidazol-2-ylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 155556013) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(1H-benzimidazol-2-ylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(1H-benzimidazol-2-ylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 155556013 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,16R,17S)-17-acetyl-16-(1H-benzimidazol-2-ylamino)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@@H](Nc5nc6ccccc6[nH]5)[C@@H](C(C)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H39N3O3/c1-17(34)27-26(33-28-31-24-7-5-6-8-25(24)32-28)16-23-21-10-9-19-15-20(36-18(2)35)11-13-29(19,3)22(21)12-14-30(23,27)4/h5-9,20-23,26-27H,10-16H2,1-4H3,(H2,31,32,33)/t20-,21+,22-,23-,26+,27+,29-,30-/m0/s1 |
| InChIKey | KLJGROCWYWPKHG-UTOWQHBJSA-N |
| XLogP | 6.05 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|