C26H36N2O4 — CID 124911095
[(3S,8R,9R,10R,13S,14R,16R,17R)-17-acetyl-16-[(1S)-2-amino-1-cyano-2-oxoethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124911095) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13S,14R,16R,17R)-17-acetyl-16-[(1S)-2-amino-1-cyano-2-oxoethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9R,10R,13S,14R,16R,17R)-17-acetyl-16-[(1S)-2-amino-1-cyano-2-oxoethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124911095 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | [(3S,8R,9R,10R,13S,14R,16R,17R)-17-acetyl-16-[(1S)-2-amino-1-cyano-2-oxoethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]4C[C@@H]([C@@H](C#N)C(N)=O)[C@@H](C(C)=O)[C@@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C26H36N2O4/c1-14(29)23-19(20(13-27)24(28)31)12-22-18-6-5-16-11-17(32-15(2)30)7-9-25(16,3)21(18)8-10-26(22,23)4/h5,17-23H,6-12H2,1-4H3,(H2,28,31)/t17-,18-,19-,20+,21+,22+,23+,25-,26-/m0/s1 |
| InChIKey | HYBIAAFEZDJSJS-CDIJOQMDSA-N |
| XLogP | 3.94 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|