C24H36O4 — CID 541144
(17-acetyl-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 541144) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (17-acetyl-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (17-acetyl-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 541144 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (17-acetyl-16-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | COC1CC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC2(C)C1C(C)=O |
| InChI | InChI=1S/C24H36O4/c1-14(25)22-21(27-5)13-20-18-7-6-16-12-17(28-15(2)26)8-10-23(16,3)19(18)9-11-24(20,22)4/h6,17-22H,7-13H2,1-5H3 |
| InChIKey | OMVHHZKDQWLSST-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|