C30H39NO5S — CID 67682608
[(3S,8S,9S,10R,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-16-[nitro(phenylsulfanyl)methyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67682608) has the molecular formula C30H39NO5S and a molecular weight of 525.71 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-16-[nitro(phenylsulfanyl)methyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-16-[nitro(phenylsulfanyl)methyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67682608 |
| Molecular Formula | C30H39NO5S |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,16S,17S)-17-acetyl-10,13-dimethyl-16-[nitro(phenylsulfanyl)methyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@H](C(Sc5ccccc5)[N+](=O)[O-])[C@H](C(C)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H39NO5S/c1-18(32)27-24(28(31(34)35)37-22-8-6-5-7-9-22)17-26-23-11-10-20-16-21(36-19(2)33)12-14-29(20,3)25(23)13-15-30(26,27)4/h5-10,21,23-28H,11-17H2,1-4H3/t21-,23+,24-,25-,26-,27-,28?,29-,30-/m0/s1 |
| InChIKey | NBHBRYJVTPGJRQ-KZFLZFMZSA-N |
| XLogP | 6.71 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|