C26H40N2O5 — CID 5070041
[17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-16-(1-nitroethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 5070041) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is [17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-16-(1-nitroethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-16-(1-nitroethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 5070041 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | [17-(N-methoxy-C-methylcarbonimidoyl)-10,13-dimethyl-16-(1-nitroethyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CON=C(C)C1C(C(C)[N+](=O)[O-])CC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C26H40N2O5/c1-15(27-32-6)24-21(16(2)28(30)31)14-23-20-8-7-18-13-19(33-17(3)29)9-11-25(18,4)22(20)10-12-26(23,24)5/h7,16,19-24H,8-14H2,1-6H3 |
| InChIKey | HMHVRHXNTPHLFZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|