C13H20O4 — CID 125035721
methyl (1S,2R,4R,5S,6R,7S,8S)-8-hydroxy-7-(hydroxymethyl)-2-methyltricyclo[3.2.2.02,4]nonane-6-carboxylate (PubChem CID 125035721) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (1S,2R,4R,5S,6R,7S,8S)-8-hydroxy-7-(hydroxymethyl)-2-methyltricyclo[3.2.2.02,4]nonane-6-carboxylate.
| Compound Name | methyl (1S,2R,4R,5S,6R,7S,8S)-8-hydroxy-7-(hydroxymethyl)-2-methyltricyclo[3.2.2.02,4]nonane-6-carboxylate |
|---|---|
| PubChem CID | 125035721 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | methyl (1S,2R,4R,5S,6R,7S,8S)-8-hydroxy-7-(hydroxymethyl)-2-methyltricyclo[3.2.2.02,4]nonane-6-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](CO)[C@@H]2[C@@H](O)C[C@H]1[C@H]1C[C@@]21C |
| InChI | InChI=1S/C13H20O4/c1-13-4-8(13)6-3-9(15)11(13)7(5-14)10(6)12(16)17-2/h6-11,14-15H,3-5H2,1-2H3/t6-,7+,8+,9-,10+,11+,13+/m0/s1 |
| InChIKey | RFWRQVBIHHAQTK-OOXHHTJLSA-N |
| XLogP | 0.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |