C24H30O8 — CID 139948153
tetramethyl hexacyclo[8.4.1.13,8.02,9.04,7.011,14]hexadecane-5,6,12,13-tetracarboxylate (PubChem CID 139948153) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is tetramethyl hexacyclo[8.4.1.13,8.02,9.04,7.011,14]hexadecane-5,6,12,13-tetracarboxylate.
| Compound Name | tetramethyl hexacyclo[8.4.1.13,8.02,9.04,7.011,14]hexadecane-5,6,12,13-tetracarboxylate |
|---|---|
| PubChem CID | 139948153 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | tetramethyl hexacyclo[8.4.1.13,8.02,9.04,7.011,14]hexadecane-5,6,12,13-tetracarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC)C2C3CC(C4C5CC(C34)C3C(C(=O)OC)C(C(=O)OC)C53)C12 |
| InChI | InChI=1S/C24H30O8/c1-29-21(25)17-13-7-5-8(14(13)18(17)22(26)30-2)12-10-6-9(11(7)12)15-16(10)20(24(28)32-4)19(15)23(27)31-3/h7-20H,5-6H2,1-4H3 |
| InChIKey | YLTVHNDCMJRABA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|