C16H20O4 — CID 124911141
dimethyl (2S,3R,6R,7S,9R,10S)-4,5-dimethylpentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate (PubChem CID 124911141) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is dimethyl (2S,3R,6R,7S,9R,10S)-4,5-dimethylpentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate.
| Compound Name | dimethyl (2S,3R,6R,7S,9R,10S)-4,5-dimethylpentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate |
|---|---|
| PubChem CID | 124911141 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | dimethyl (2S,3R,6R,7S,9R,10S)-4,5-dimethylpentacyclo[4.4.0.02,4.03,8.05,7]decane-9,10-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C2[C@@H]3[C@@H]4C([C@@H]5[C@H]2C5(C)C34C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H20O4/c1-15-9-7-5(13(17)19-3)6(14(18)20-4)8(10(9)15)12-11(7)16(12,15)2/h5-12H,1-4H3/t5-,6+,7?,8?,9-,10+,11+,12-,15?,16? |
| InChIKey | JAJDGRWTMITQCP-OXQLYTCGSA-N |
| XLogP | 1.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |