C18H22O4 — CID 124788715
dimethyl (1R,2R,3R,4S,5R,6S,7R,8S,9S,10R)-hexacyclo[6.6.0.01,10.02,7.05,10.06,9]tetradecane-3,4-dicarboxylate (PubChem CID 124788715) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is dimethyl (1R,2R,3R,4S,5R,6S,7R,8S,9S,10R)-hexacyclo[6.6.0.01,10.02,7.05,10.06,9]tetradecane-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3R,4S,5R,6S,7R,8S,9S,10R)-hexacyclo[6.6.0.01,10.02,7.05,10.06,9]tetradecane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 124788715 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | dimethyl (1R,2R,3R,4S,5R,6S,7R,8S,9S,10R)-hexacyclo[6.6.0.01,10.02,7.05,10.06,9]tetradecane-3,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@H]2[C@@H]3[C@@H]4[C@H]1[C@]15CCCC[C@@]21[C@@H]3[C@H]45 |
| InChI | InChI=1S/C18H22O4/c1-21-15(19)9-10(16(20)22-2)12-8-7-11(9)17-5-3-4-6-18(12,17)14(8)13(7)17/h7-14H,3-6H2,1-2H3/t7-,8+,9-,10+,11-,12-,13+,14+,17+,18+/m1/s1 |
| InChIKey | DTUJSPXZJGULOB-OQIUVHCTSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |