C26H34O10 — CID 92975608
tetramethyl (6Z,13S,15R,16R,18R)-14,17-dioxotricyclo[10.3.3.01,12]octadec-6-ene-13,15,16,18-tetracarboxylate (PubChem CID 92975608) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is tetramethyl (6Z,13S,15R,16R,18R)-14,17-dioxotricyclo[10.3.3.01,12]octadec-6-ene-13,15,16,18-tetracarboxylate.
| Compound Name | tetramethyl (6Z,13S,15R,16R,18R)-14,17-dioxotricyclo[10.3.3.01,12]octadec-6-ene-13,15,16,18-tetracarboxylate |
|---|---|
| PubChem CID | 92975608 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | tetramethyl (6Z,13S,15R,16R,18R)-14,17-dioxotricyclo[10.3.3.01,12]octadec-6-ene-13,15,16,18-tetracarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@H](C(=O)OC)C23CCCC/C=C\CCCCC12[C@@H](C(=O)OC)C(=O)[C@@H]3C(=O)OC |
| InChI | InChI=1S/C26H34O10/c1-33-21(29)15-19(27)16(22(30)34-2)26-14-12-10-8-6-5-7-9-11-13-25(15,26)17(23(31)35-3)20(28)18(26)24(32)36-4/h5-6,15-18H,7-14H2,1-4H3/b6-5-/t15-,16-,17-,18+,25?,26?/m1/s1 |
| InChIKey | BYXGTOLZSAQYLZ-QESYHYQBSA-N |
| XLogP | 1.97 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|