C28H32O10 — CID 125036003
tetramethyl (5S,7S,18S,20R)-6,19-dioxopentacyclo[9.3.3.34,8.01,11.04,8]icosa-12,16-diene-5,7,18,20-tetracarboxylate (PubChem CID 125036003) has the molecular formula C28H32O10 and a molecular weight of 528.55 g/mol. Its IUPAC name is tetramethyl (5S,7S,18S,20R)-6,19-dioxopentacyclo[9.3.3.34,8.01,11.04,8]icosa-12,16-diene-5,7,18,20-tetracarboxylate.
| Compound Name | tetramethyl (5S,7S,18S,20R)-6,19-dioxopentacyclo[9.3.3.34,8.01,11.04,8]icosa-12,16-diene-5,7,18,20-tetracarboxylate |
|---|---|
| PubChem CID | 125036003 |
| Molecular Formula | C28H32O10 |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | tetramethyl (5S,7S,18S,20R)-6,19-dioxopentacyclo[9.3.3.34,8.01,11.04,8]icosa-12,16-diene-5,7,18,20-tetracarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@@H](C(=O)OC)C23CCC45CC=CC4(C=CC5)CCC12[C@H](C(=O)OC)C(=O)[C@@H]3C(=O)OC |
| InChI | InChI=1S/C28H32O10/c1-35-21(31)15-19(29)16(22(32)36-2)28-14-12-26-9-5-7-25(26,8-6-10-26)11-13-27(15,28)17(23(33)37-3)20(30)18(28)24(34)38-4/h5-8,15-18H,9-14H2,1-4H3/t15-,16-,17-,18+,25?,26?,27?,28?/m0/s1 |
| InChIKey | SSECTZNMULKWOP-HNVBHWANSA-N |
| XLogP | 1.75 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|