C13H17ClO3 — CID 11821225
methyl (4aR,7R,8aS)-7-chloro-4a-methyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 11821225) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is methyl (4aR,7R,8aS)-7-chloro-4a-methyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aR,7R,8aS)-7-chloro-4a-methyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11821225 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl (4aR,7R,8aS)-7-chloro-4a-methyl-2-oxo-1,5,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C=C[C@@]2(C)CC[C@@H](Cl)C[C@@H]12 |
| InChI | InChI=1S/C13H17ClO3/c1-13-5-3-8(14)7-9(13)11(12(16)17-2)10(15)4-6-13/h4,6,8-9,11H,3,5,7H2,1-2H3/t8-,9+,11?,13-/m1/s1 |
| InChIKey | UIAXXWPYFKAKSW-FUPNVVMTSA-N |
| XLogP | 2.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|