C13H17ClO3 — CID 102585617
methyl (1S,3S,6S,8R)-3-chloro-1-methyl-4-oxotricyclo[4.4.0.02,8]decane-5-carboxylate (PubChem CID 102585617) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is methyl (1S,3S,6S,8R)-3-chloro-1-methyl-4-oxotricyclo[4.4.0.02,8]decane-5-carboxylate.
| Compound Name | methyl (1S,3S,6S,8R)-3-chloro-1-methyl-4-oxotricyclo[4.4.0.02,8]decane-5-carboxylate |
|---|---|
| PubChem CID | 102585617 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl (1S,3S,6S,8R)-3-chloro-1-methyl-4-oxotricyclo[4.4.0.02,8]decane-5-carboxylate |
| SMILES | COC(=O)C1C(=O)C(Cl)C2[C@@H]3CC[C@@]2(C)[C@H]1C3 |
| InChI | InChI=1S/C13H17ClO3/c1-13-4-3-6-5-7(13)8(12(16)17-2)11(15)10(14)9(6)13/h6-10H,3-5H2,1-2H3/t6-,7+,8?,9?,10?,13+/m1/s1 |
| InChIKey | FOTRSADAGKGARR-KVBDKOEZSA-N |
| XLogP | 2.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|