C8H10O3S — CID 145293977
methyl 2-oxo-6-sulfanylcyclohex-3-ene-1-carboxylate (PubChem CID 145293977) has the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. Its IUPAC name is methyl 2-oxo-6-sulfanylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 2-oxo-6-sulfanylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 145293977 |
| Molecular Formula | C8H10O3S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | methyl 2-oxo-6-sulfanylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C=CCC1S |
| InChI | InChI=1S/C8H10O3S/c1-11-8(10)7-5(9)3-2-4-6(7)12/h2-3,6-7,12H,4H2,1H3 |
| InChIKey | LOEMMWVNXQHYNU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|