C12H14O4 — CID 11557612
methyl (3aR,4R,7aS)-4-methoxy-1-oxo-7,7a-dihydro-4H-indene-3a-carboxylate (PubChem CID 11557612) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl (3aR,4R,7aS)-4-methoxy-1-oxo-7,7a-dihydro-4H-indene-3a-carboxylate.
| Compound Name | methyl (3aR,4R,7aS)-4-methoxy-1-oxo-7,7a-dihydro-4H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 11557612 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | methyl (3aR,4R,7aS)-4-methoxy-1-oxo-7,7a-dihydro-4H-indene-3a-carboxylate |
| SMILES | COC(=O)[C@]12C=CC(=O)[C@H]1CC=C[C@H]2OC |
| InChI | InChI=1S/C12H14O4/c1-15-10-5-3-4-8-9(13)6-7-12(8,10)11(14)16-2/h3,5-8,10H,4H2,1-2H3/t8-,10-,12-/m1/s1 |
| InChIKey | DEUBZBAQBDDIKZ-HLUHBDAQSA-N |
| XLogP | 0.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|